![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 9c96051926a88a6ed2.pdf | 21-Oct-2013 03:37 | 925K | |
| 33_JES_Solid_phase_reformulation.pdf | 16-Oct-2013 14:16 | 384K | |
| 2011 MAthemAticAl modeling of A lithium ion bAttery with themAl effects in COMSOL Inc. Multiphysics CAi White.pdf | 16-Oct-2013 14:16 | 1.0M | |
| 2013_Gurevitch_JElectrochemSoc_NanoComposites.pdf | 21-Oct-2013 03:05 | 1.7M | |
| Dombi/ | 31-Aug-2017 18:56 | - | |
| ESZKÖZÖK_ÖSSZESÍTŐ TÁBLÁZAT_tanszéki nyilvántartás_2017júniusi állapot.xls | 09-Sep-2017 11:44 | 92K | |
| Héreg/ | 10-Sep-2017 06:54 | - | |
| Smith_IEEET_2010.pdf | 16-Oct-2013 14:16 | 1.5M | |
| Tan_Single_Variable_Calculus.pdf | 28-Jul-2017 06:06 | 66M | |
| Vica/ | 05-Feb-2018 11:12 | - | |
| Vorfusch/ | 21-Aug-2017 16:34 | - | |
| irodalomkutatás.pdf | 21-Oct-2013 14:59 | 87K | |
| jazz/ | 24-Feb-2022 13:45 | - | |
| jegyz/ | 20-Sep-2017 19:09 | - | |
| kapcsolódó anyagok/ | 21-Oct-2013 16:23 | - | |